* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | KINGSHCHEM 36665 |
| English Synonyms: | KINGSHCHEM 36665 |
| MDL Number.: | MFCD16306379 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | COc1cccc2c1CCC2CC(=O)O |
| InChi: | InChI=1S/C12H14O3/c1-15-11-4-2-3-9-8(7-12(13)14)5-6-10(9)11/h2-4,8H,5-7H2,1H3,(H,13,14) |
| InChiKey: | InChIKey=VKFYNEPLXVICRL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.