* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | KINGSHCHEM 36755 |
| English Synonyms: | KINGSHCHEM 36755 |
| MDL Number.: | MFCD16312362 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | COc1cc2c(c(c1)OC)CCC2CCO |
| InChi: | InChI=1S/C13H18O3/c1-15-10-7-12-9(5-6-14)3-4-11(12)13(8-10)16-2/h7-9,14H,3-6H2,1-2H3 |
| InChiKey: | InChIKey=FKPATYFNOCXTPC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.