Molecular Structure:
CCD No.:CCD02786712
OTAVA-BB 1813360
Formula:C14 H20 N2 O2
MolWeight:248.324
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 1813360 |
| English Synonyms： | OTAVA-BB 1813360 |
| MDL Number.： | MFCD16325688 |
| H bond acceptor： | 4 |
| H bond donor： | 1 |
| Smile： | Cc1ccc(c(c1)CC(=O)N2CCNCC2)OC |
| InChi： | InChI=1S/C14H20N2O2/c1-11-3-4-13(18-2)12(9-11)10-14(17)16-7-5-15-6-8-16/h3-4,9,15H,5-8,10H2,1-2H3 |
| InChiKey： | InChIKey=YBIQQZGVNGOWOZ-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
