Molecular Structure:
CCD No.:CCD02786754
OTAVA-BB 1813414
Formula:C17 H16 N2
MolWeight:248.327
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 1813414 |
| English Synonyms： | OTAVA-BB 1813414 |
| MDL Number.： | MFCD16325730 |
| H bond acceptor： | 2 |
| H bond donor： | 1 |
| Smile： | Cc1ccc(c(c1)c2cc(c3ccccc3n2)N)C |
| InChi： | InChI=1S/C17H16N2/c1-11-7-8-12(2)14(9-11)17-10-15(18)13-5-3-4-6-16(13)19-17/h3-10H,1-2H3,(H2,18,19) |
| InChiKey： | InChIKey=DQWQCRZYBNITTR-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
