Molecular Structure:
CCD No.:CCD02786756
OTAVA-BB 1813416
Formula:C13 H20 N4 O
MolWeight:248.328
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 1813416 |
| English Synonyms： | OTAVA-BB 1813416 |
| MDL Number.： | MFCD16325732 |
| H bond acceptor： | 5 |
| H bond donor： | 1 |
| Smile： | CN(C)C(c1cccnc1)C(=O)N2CCNCC2 |
| InChi： | InChI=1S/C13H20N4O/c1-16(2)12(11-4-3-5-15-10-11)13(18)17-8-6-14-7-9-17/h3-5,10,12,14H,6-9H2,1-2H3 |
| InChiKey： | InChIKey=JCBAGTNNFNIEJE-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
