Molecular Structure:
CCD No.:CCD02786762
OTAVA-BB 1813422
Formula:C14 H16 O2 S
MolWeight:248.344
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 1813422 |
| English Synonyms： | OTAVA-BB 1813422 |
| MDL Number.： | MFCD16325738 |
| H bond acceptor： | 2 |
| H bond donor： | 1 |
| Smile： | Cc1cc(c(cc1C)OC)c2ccc(s2)CO |
| InChi： | InChI=1S/C14H16O2S/c1-9-6-12(13(16-3)7-10(9)2)14-5-4-11(8-15)17-14/h4-7,15H,8H2,1-3H3 |
| InChiKey： | InChIKey=HUSXYHLXPSXART-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
