* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | OTAVA-BB 1813437 |
English Synonyms: | OTAVA-BB 1813437 |
MDL Number.: | MFCD16325752 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CCOC1=CC=C(CCC2=CSC(N)=N2)C=C1 |
InChi: | InChI=1S/C13H16N2OS/c1-2-16-12-7-4-10(5-8-12)3-6-11-9-17-13(14)15-11/h4-5,7-9H,2-3,6H2,1H3,(H2,14,15) |
InChiKey: | InChIKey=KICUBRCRGSMJPO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.