Molecular Structure:
CCD No.:CCD02787491
OTAVA-BB 1814291
Formula:C15 H23 N O2
MolWeight:249.352
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 1814291 |
| English Synonyms： | OTAVA-BB 1814291 |
| MDL Number.： | MFCD16326467 |
| H bond acceptor： | 3 |
| H bond donor： | 1 |
| Smile： | Cc1ccc(cc1C(C(=O)O)N(C)C)C(C)(C)C |
| InChi： | InChI=1S/C15H23NO2/c1-10-7-8-11(15(2,3)4)9-12(10)13(14(17)18)16(5)6/h7-9,13H,1-6H3,(H,17,18) |
| InChiKey： | InChIKey=PHHALGAPNIVDIY-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
