* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | OTAVA-BB 1814358 |
English Synonyms: | OTAVA-BB 1814358 |
MDL Number.: | MFCD16326519 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | CC1=CC(OCCC(O)C2CCCN2)=C(C)C=C1 |
InChi: | InChI=1S/C15H23NO2/c1-11-5-6-12(2)15(10-11)18-9-7-14(17)13-4-3-8-16-13/h5-6,10,13-14,16-17H,3-4,7-9H2,1-2H3 |
InChiKey: | InChIKey=CYABSFUJTPHVOF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.