* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | OTAVA-BB 1814373 |
English Synonyms: | OTAVA-BB 1814373 |
MDL Number.: | MFCD16326533 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | NCCC(O)CCOC1=CC2=C(CCCC2)C=C1 |
InChi: | InChI=1S/C15H23NO2/c16-9-7-14(17)8-10-18-15-6-5-12-3-1-2-4-13(12)11-15/h5-6,11,14,17H,1-4,7-10,16H2 |
InChiKey: | InChIKey=AYUQUQPQWZUOOO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.