* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | OTAVA-BB 1815145 |
English Synonyms: | OTAVA-BB 1815145 |
MDL Number.: | MFCD16327197 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | COC1=CC=CC(OCCN2CCCNCC2)=C1 |
InChi: | InChI=1S/C14H22N2O2/c1-17-13-4-2-5-14(12-13)18-11-10-16-8-3-6-15-7-9-16/h2,4-5,12,15H,3,6-11H2,1H3 |
InChiKey: | InChIKey=OFQVFBOKBJTENT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.