* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | OTAVA-BB 1815184 |
| English Synonyms: | OTAVA-BB 1815184 |
| MDL Number.: | MFCD16327234 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | CC(N)C(=O)NCCCOC1=CC(C)=CC(C)=C1 |
| InChi: | InChI=1S/C14H22N2O2/c1-10-7-11(2)9-13(8-10)18-6-4-5-16-14(17)12(3)15/h7-9,12H,4-6,15H2,1-3H3,(H,16,17) |
| InChiKey: | InChIKey=OSRBCSSQUVCPHD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.