* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | OTAVA-BB 1815307 |
English Synonyms: | OTAVA-BB 1815307 |
MDL Number.: | MFCD16327340 |
H bond acceptor: | 2 |
H bond donor: | 2 |
Smile: | CC(CNC1=C(C=CC=C1)C(C)(C)C)C(N)=S |
InChi: | InChI=1S/C14H22N2S/c1-10(13(15)17)9-16-12-8-6-5-7-11(12)14(2,3)4/h5-8,10,16H,9H2,1-4H3,(H2,15,17) |
InChiKey: | InChIKey=FKJNZZVZTORSRO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.