Molecular Structure:
CCD No.:CCD02788596
OTAVA-BB 1815616
Formula:C14 H18 F N O2
MolWeight:251.299
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 1815616 |
| English Synonyms： | OTAVA-BB 1815616 |
| MDL Number.： | MFCD16327572 |
| H bond acceptor： | 3 |
| H bond donor： | 1 |
| Smile： | COc1ccc(cc1F)CC(=O)C2CCNCC2 |
| InChi： | InChI=1S/C14H18FNO2/c1-18-14-3-2-10(8-12(14)15)9-13(17)11-4-6-16-7-5-11/h2-3,8,11,16H,4-7,9H2,1H3 |
| InChiKey： | InChIKey=IUFATRXQGUDMPN-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
