Molecular Structure:
CCD No.:CCD02788949
OTAVA-BB 1816045
Formula:C11 H10 Cl N3 O2
MolWeight:251.672
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 1816045 |
| English Synonyms： | OTAVA-BB 1816045 |
| MDL Number.： | MFCD16327925 |
| H bond acceptor： | 5 |
| H bond donor： | 2 |
| Smile： | Cn1c(c(c(n1)C(=O)O)c2ccccc2Cl)N |
| InChi： | InChI=1S/C11H10ClN3O2/c1-15-10(13)8(9(14-15)11(16)17)6-4-2-3-5-7(6)12/h2-5H,13H2,1H3,(H,16,17) |
| InChiKey： | InChIKey=GDXKWAMIWZUOLJ-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
