Molecular Structure:
CCD No.:CCD02788985
OTAVA-BB 1816086
Formula:C12 H14 Cl N3 O
MolWeight:251.716
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 1816086 |
| English Synonyms： | OTAVA-BB 1816086 |
| MDL Number.： | MFCD16327961 |
| H bond acceptor： | 4 |
| H bond donor： | 2 |
| Smile： | CCc1c(c(n[nH]1)N)c2cc(ccc2OC)Cl |
| InChi： | InChI=1S/C12H14ClN3O/c1-3-9-11(12(14)16-15-9)8-6-7(13)4-5-10(8)17-2/h4-6H,3H2,1-2H3,(H3,14,15,16) |
| InChiKey： | InChIKey=UONAGRCFSXKSFC-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
