Molecular Structure:
CCD No.:CCD02789565
OTAVA-BB 1816761
Formula:C14 H21 Cl N2
MolWeight:252.787
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 1816761 |
| English Synonyms： | OTAVA-BB 1816761 |
| MDL Number.： | MFCD16328541 |
| H bond acceptor： | 2 |
| H bond donor： | 1 |
| Smile： | c1cc(ccc1CC(CN)N2CCCCC2)Cl |
| InChi： | InChI=1S/C14H21ClN2/c15-13-6-4-12(5-7-13)10-14(11-16)17-8-2-1-3-9-17/h4-7,14H,1-3,8-11,16H2 |
| InChiKey： | InChIKey=GXFUNRWGOVLFIC-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
