* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | OTAVA-BB 1817036 |
English Synonyms: | OTAVA-BB 1817036 |
MDL Number.: | MFCD16328753 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | COc1ccc(cc1)n2c(cc(n2)CC#N)C3CC3 |
InChi: | InChI=1S/C15H15N3O/c1-19-14-6-4-13(5-7-14)18-15(11-2-3-11)10-12(17-18)8-9-16/h4-7,10-11H,2-3,8H2,1H3 |
InChiKey: | InChIKey=VFRNGPQPAFSBBE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.