* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | OTAVA-BB 1817798 |
English Synonyms: | OTAVA-BB 1817798 |
MDL Number.: | MFCD16329374 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | COC1=CC(OC)=C(NC(C)CC(N)=S)C=C1 |
InChi: | InChI=1S/C12H18N2O2S/c1-8(6-12(13)17)14-10-5-4-9(15-2)7-11(10)16-3/h4-5,7-8,14H,6H2,1-3H3,(H2,13,17) |
InChiKey: | InChIKey=SWMVRWUVYJUSLC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.