* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | OTAVA-BB 1818604 |
English Synonyms: | OTAVA-BB 1818604 |
MDL Number.: | MFCD16330029 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | CC1=C(CCC2NCCC3=C2CCCC3)C=CC=C1 |
InChi: | InChI=1S/C18H25N/c1-14-6-2-3-7-15(14)10-11-18-17-9-5-4-8-16(17)12-13-19-18/h2-3,6-7,18-19H,4-5,8-13H2,1H3 |
InChiKey: | InChIKey=CXTDGETTYSCPEV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.