* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | OTAVA-BB 1818647 |
English Synonyms: | OTAVA-BB 1818647 |
MDL Number.: | MFCD16330068 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | CCC(=O)NC(CC1=CC(Cl)=CC=C1)C(O)=O |
InChi: | InChI=1S/C12H14ClNO3/c1-2-11(15)14-10(12(16)17)7-8-4-3-5-9(13)6-8/h3-6,10H,2,7H2,1H3,(H,14,15)(H,16,17) |
InChiKey: | InChIKey=KZYDSQADVUWCTG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.