Molecular Structure:
CCD No.:CCD02791114
OTAVA-BB 1818677
Formula:C13 H18 Cl N O2
MolWeight:255.743
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 1818677 |
| English Synonyms： | OTAVA-BB 1818677 |
| MDL Number.： | MFCD16330090 |
| H bond acceptor： | 3 |
| H bond donor： | 1 |
| Smile： | CC1(OCCCO1)CC(c2ccc(cc2)Cl)N |
| InChi： | InChI=1S/C13H18ClNO2/c1-13(16-7-2-8-17-13)9-12(15)10-3-5-11(14)6-4-10/h3-6,12H,2,7-9,15H2,1H3 |
| InChiKey： | InChIKey=STYWXKLSWBJABE-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
