Molecular Structure:
CCD No.:CCD02791908
OTAVA-BB 1819655
Formula:C15 H15 N O3
MolWeight:257.288
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 1819655 |
| English Synonyms： | OTAVA-BB 1819655 |
| MDL Number.： | MFCD16330884 |
| H bond acceptor： | 4 |
| H bond donor： | 1 |
| Smile： | COc1cccc(c1)C(=O)c2cc(ccc2OC)N |
| InChi： | InChI=1S/C15H15NO3/c1-18-12-5-3-4-10(8-12)15(17)13-9-11(16)6-7-14(13)19-2/h3-9H,16H2,1-2H3 |
| InChiKey： | InChIKey=VTVQWYHPISBGAN-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
