Molecular Structure:
CCD No.:CCD02793138
OTAVA-BB 1821249
Formula:C15 H17 N O3
MolWeight:259.303
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 1821249 |
| English Synonyms： | OTAVA-BB 1821249 |
| MDL Number.： | MFCD16332114 |
| H bond acceptor： | 4 |
| H bond donor： | 1 |
| Smile： | CC(C)n1c(ccc1C(=O)O)c2cccc(c2)OC |
| InChi： | InChI=1S/C15H17NO3/c1-10(2)16-13(7-8-14(16)15(17)18)11-5-4-6-12(9-11)19-3/h4-10H,1-3H3,(H,17,18) |
| InChiKey： | InChIKey=TXMWAFNEEDFOIS-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
