* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | OTAVA-BB 1821344 |
English Synonyms: | OTAVA-BB 1821344 |
MDL Number.: | MFCD16332201 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | CCCC(CCNC)C1=CC=C(C=C1)C(F)(F)F |
InChi: | InChI=1S/C14H20F3N/c1-3-4-11(9-10-18-2)12-5-7-13(8-6-12)14(15,16)17/h5-8,11,18H,3-4,9-10H2,1-2H3 |
InChiKey: | InChIKey=ONZFMLVSCXTBAK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.