* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | OTAVA-BB 1822112 |
English Synonyms: | OTAVA-BB 1822112 |
MDL Number.: | MFCD16332872 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | NC1=CC(=NC2=CC=CC=C12)C1=CC2=C(CCC2)C=C1 |
InChi: | InChI=1S/C18H16N2/c19-16-11-18(20-17-7-2-1-6-15(16)17)14-9-8-12-4-3-5-13(12)10-14/h1-2,6-11H,3-5H2,(H2,19,20) |
InChiKey: | InChIKey=YYEAQRYGGNBWRL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.