* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | OTAVA-BB 1822113 |
English Synonyms: | OTAVA-BB 1822113 |
MDL Number.: | MFCD16332873 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | N#CC1=CN(CCCC2=CC=CC=C2)C2=C1C=CC=C2 |
InChi: | InChI=1S/C18H16N2/c19-13-16-14-20(18-11-5-4-10-17(16)18)12-6-9-15-7-2-1-3-8-15/h1-5,7-8,10-11,14H,6,9,12H2 |
InChiKey: | InChIKey=LYXBSTDXYSPUMF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.