* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | OTAVA-BB 1822138 |
English Synonyms: | OTAVA-BB 1822138 |
MDL Number.: | MFCD16332893 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | CCOc1cc(c(cc1C)c2ccnc(n2)S)C |
InChi: | InChI=1S/C14H16N2OS/c1-4-17-13-8-9(2)11(7-10(13)3)12-5-6-15-14(18)16-12/h5-8H,4H2,1-3H3,(H,15,16,18) |
InChiKey: | InChIKey=RQAGPKBTXAYYDF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.