* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | OTAVA-BB 1822936 |
English Synonyms: | OTAVA-BB 1822936 |
MDL Number.: | MFCD16333577 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | COC1=C(C=C(C=C1)C(CC(N)=O)C1CC1)C(C)C |
InChi: | InChI=1S/C16H23NO2/c1-10(2)13-8-12(6-7-15(13)19-3)14(9-16(17)18)11-4-5-11/h6-8,10-11,14H,4-5,9H2,1-3H3,(H2,17,18) |
InChiKey: | InChIKey=ISKOMLZCIWOEFW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.