* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | OTAVA-BB 1823020 |
English Synonyms: | OTAVA-BB 1823020 |
MDL Number.: | MFCD16333656 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | CC(=O)NC1=CC=C(NCCN2CCCCC2)C=C1 |
InChi: | InChI=1S/C15H23N3O/c1-13(19)17-15-7-5-14(6-8-15)16-9-12-18-10-3-2-4-11-18/h5-8,16H,2-4,9-12H2,1H3,(H,17,19) |
InChiKey: | InChIKey=JYWFRUYJAUHTBH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.