Molecular Structure:
CCD No.:CCD02795014
OTAVA-BB 1823399
Formula:C13 H12 Br N
MolWeight:262.149
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 1823399 |
| English Synonyms： | OTAVA-BB 1823399 |
| MDL Number.： | MFCD16333990 |
| H bond acceptor： | 1 |
| H bond donor： | 0 |
| Smile： | Cc1cc(cc(c1)c2ccc(nc2)Br)C |
| InChi： | InChI=1S/C13H12BrN/c1-9-5-10(2)7-12(6-9)11-3-4-13(14)15-8-11/h3-8H,1-2H3 |
| InChiKey： | InChIKey=VNVJRMPXHMLKTN-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
