* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | OTAVA-BB 1823722 |
| English Synonyms: | OTAVA-BB 1823722 |
| MDL Number.: | MFCD16334269 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | CCC1=CC=C(S1)S(=O)(=O)NCCC(N)=O |
| InChi: | InChI=1S/C9H14N2O3S2/c1-2-7-3-4-9(15-7)16(13,14)11-6-5-8(10)12/h3-4,11H,2,5-6H2,1H3,(H2,10,12) |
| InChiKey: | InChIKey=JLABREGLRCIORB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.