* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | OTAVA-BB 1823723 |
| English Synonyms: | OTAVA-BB 1823723 |
| MDL Number.: | MFCD16334270 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CCC1=CC=C(S1)S(=O)(=O)N(C)CC(N)=O |
| InChi: | InChI=1S/C9H14N2O3S2/c1-3-7-4-5-9(15-7)16(13,14)11(2)6-8(10)12/h4-5H,3,6H2,1-2H3,(H2,10,12) |
| InChiKey: | InChIKey=BVZIFCOASSPKOE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.