* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | OTAVA-BB 1823784 |
| English Synonyms: | OTAVA-BB 1823784 |
| MDL Number.: | MFCD16334331 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CC(C)C(\COC1=CC=C(C=C1)C(C)C)=C/C(O)=O |
| InChi: | InChI=1S/C16H22O3/c1-11(2)13-5-7-15(8-6-13)19-10-14(12(3)4)9-16(17)18/h5-9,11-12H,10H2,1-4H3,(H,17,18)/b14-9- |
| InChiKey: | InChIKey=XCEUHNFVJXPBOL-ZROIWOOFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.