Molecular Structure:
CCD No.:CCD02796007
OTAVA-BB 1824556
Formula:C12 H11 Br N2
MolWeight:263.137
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 1824556 |
| English Synonyms： | OTAVA-BB 1824556 |
| MDL Number.： | MFCD16334983 |
| H bond acceptor： | 2 |
| H bond donor： | 0 |
| Smile： | Cc1ccc(c(c1)c2ccc(nn2)Br)C |
| InChi： | InChI=1S/C12H11BrN2/c1-8-3-4-9(2)10(7-8)11-5-6-12(13)15-14-11/h3-7H,1-2H3 |
| InChiKey： | InChIKey=SXCTZZYEMWLVCY-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
