* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | OTAVA-BB 1824572 |
| English Synonyms: | OTAVA-BB 1824572 |
| MDL Number.: | MFCD16334993 |
| H bond acceptor: | 2 |
| H bond donor: | 2 |
| Smile: | CC(CNC1=CC(Cl)=C(Cl)C=C1)C(N)=S |
| InChi: | InChI=1S/C10H12Cl2N2S/c1-6(10(13)15)5-14-7-2-3-8(11)9(12)4-7/h2-4,6,14H,5H2,1H3,(H2,13,15) |
| InChiKey: | InChIKey=ICEVMNMKNXVVMS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.