Molecular Structure:
CCD No.:CCD02796043
OTAVA-BB 1824601
Formula:C13 H13 N O5
MolWeight:263.248
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 1824601 |
| English Synonyms： | OTAVA-BB 1824601 |
| MDL Number.： | MFCD16335019 |
| H bond acceptor： | 6 |
| H bond donor： | 1 |
| Smile： | COc1ccccc1C2CC(=O)N(C2=O)CC(=O)O |
| InChi： | InChI=1S/C13H13NO5/c1-19-10-5-3-2-4-8(10)9-6-11(15)14(13(9)18)7-12(16)17/h2-5,9H,6-7H2,1H3,(H,16,17) |
| InChiKey： | InChIKey=HIJBWAGUBWRKKR-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
