* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | OTAVA-BB 1824605 |
English Synonyms: | OTAVA-BB 1824605 |
MDL Number.: | MFCD16335022 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | c1cc2c(cc1C(C(=O)O)NC(=O)C3CC3)OCO2 |
InChi: | InChI=1S/C13H13NO5/c15-12(7-1-2-7)14-11(13(16)17)8-3-4-9-10(5-8)19-6-18-9/h3-5,7,11H,1-2,6H2,(H,14,15)(H,16,17) |
InChiKey: | InChIKey=OFIYWPGNWVEBMJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.