* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | OTAVA-BB 1824727 |
English Synonyms: | OTAVA-BB 1824727 |
MDL Number.: | MFCD16335129 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | COC1=CC(OCCC2=NNC(N)=C2)=CC(OC)=C1 |
InChi: | InChI=1S/C13H17N3O3/c1-17-10-6-11(18-2)8-12(7-10)19-4-3-9-5-13(14)16-15-9/h5-8H,3-4H2,1-2H3,(H3,14,15,16) |
InChiKey: | InChIKey=YUESCSSJMYXQQW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.