* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | OTAVA-BB 1825312 |
| English Synonyms: | OTAVA-BB 1825312 |
| MDL Number.: | MFCD16335659 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CC(C)(C)CNCCOC1=C(C=CC=C1)C(C)(C)C |
| InChi: | InChI=1S/C17H29NO/c1-16(2,3)13-18-11-12-19-15-10-8-7-9-14(15)17(4,5)6/h7-10,18H,11-13H2,1-6H3 |
| InChiKey: | InChIKey=KNWVDNDIPVYPHA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.