Molecular Structure:
CCD No.:CCD02796733
OTAVA-BB 1825371
Formula:C14 H14 Cl N O2
MolWeight:263.723
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 1825371 |
| English Synonyms： | OTAVA-BB 1825371 |
| MDL Number.： | MFCD16335709 |
| H bond acceptor： | 3 |
| H bond donor： | 2 |
| Smile： | CC(C)c1c(cc([nH]1)c2ccc(cc2)Cl)C(=O)O |
| InChi： | InChI=1S/C14H14ClNO2/c1-8(2)13-11(14(17)18)7-12(16-13)9-3-5-10(15)6-4-9/h3-8,16H,1-2H3,(H,17,18) |
| InChiKey： | InChIKey=OVKSHVQVZNHECJ-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
