Molecular Structure:
CCD No.:CCD02796751
OTAVA-BB 1825394
Formula:C15 H18 Cl N O
MolWeight:263.766
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 1825394 |
| English Synonyms： | OTAVA-BB 1825394 |
| MDL Number.： | MFCD16335727 |
| H bond acceptor： | 2 |
| H bond donor： | 0 |
| Smile： | Cc1ccc(n1CCOc2ccc(c(c2)C)Cl)C |
| InChi： | InChI=1S/C15H18ClNO/c1-11-10-14(6-7-15(11)16)18-9-8-17-12(2)4-5-13(17)3/h4-7,10H,8-9H2,1-3H3 |
| InChiKey： | InChIKey=KJKMWCAGFRUZPL-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
