Molecular Structure:
CCD No.:CCD02797382
OTAVA-BB 1826121
Formula:C13 H13 Cl N2 O2
MolWeight:264.711
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 1826121 |
| English Synonyms： | OTAVA-BB 1826121 |
| MDL Number.： | MFCD16336358 |
| H bond acceptor： | 4 |
| H bond donor： | 1 |
| Smile： | Cc1cc(nn1c2cccc(c2C)Cl)CC(=O)O |
| InChi： | InChI=1S/C13H13ClN2O2/c1-8-6-10(7-13(17)18)15-16(8)12-5-3-4-11(14)9(12)2/h3-6H,7H2,1-2H3,(H,17,18) |
| InChiKey： | InChIKey=VXORBTNIAUQCIL-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
