Molecular Structure:
CCD No.:CCD02797401
OTAVA-BB 1826140
Formula:C14 H14 Cl F N2
MolWeight:264.73
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 1826140 |
| English Synonyms： | OTAVA-BB 1826140 |
| MDL Number.： | MFCD16336377 |
| H bond acceptor： | 2 |
| H bond donor： | 1 |
| Smile： | c1ccnc(c1)C(Cc2c(cccc2Cl)F)CN |
| InChi： | InChI=1S/C14H14ClFN2/c15-12-4-3-5-13(16)11(12)8-10(9-17)14-6-1-2-7-18-14/h1-7,10H,8-9,17H2 |
| InChiKey： | InChIKey=NDXKSKAPZNMIGQ-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
