* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | OTAVA-BB 1826145 |
| English Synonyms: | OTAVA-BB 1826145 |
| MDL Number.: | MFCD16336379 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | OC(=O)\C=C(/C1CCCCC1)C1=CC(Cl)=CC=C1 |
| InChi: | InChI=1S/C15H17ClO2/c16-13-8-4-7-12(9-13)14(10-15(17)18)11-5-2-1-3-6-11/h4,7-11H,1-3,5-6H2,(H,17,18)/b14-10+ |
| InChiKey: | InChIKey=WFKXRJLNMMZOGH-GXDHUFHOSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.