* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | OTAVA-BB 1826171 |
| English Synonyms: | OTAVA-BB 1826171 |
| MDL Number.: | MFCD16336402 |
| H bond acceptor: | 0 |
| H bond donor: | 0 |
| Smile: | CCCC(CCl)C1=CC=C(C=C1)C1CCCCC1 |
| InChi: | InChI=1S/C17H25Cl/c1-2-6-17(13-18)16-11-9-15(10-12-16)14-7-4-3-5-8-14/h9-12,14,17H,2-8,13H2,1H3 |
| InChiKey: | InChIKey=MKPCGCMKOWBSGF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.