* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | OTAVA-BB 1826174 |
| English Synonyms: | OTAVA-BB 1826174 |
| MDL Number.: | MFCD16336404 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | OC(COC1=C(Cl)C=CC=C1Cl)CC(O)=O |
| InChi: | InChI=1S/C10H10Cl2O4/c11-7-2-1-3-8(12)10(7)16-5-6(13)4-9(14)15/h1-3,6,13H,4-5H2,(H,14,15) |
| InChiKey: | InChIKey=POTXYZJUWLTTSG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.