* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX115004 |
English Synonyms: | WUXIAPPTEC WX115004 |
MDL Number.: | MFCD16605960 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | CC(C)(C)OC(=O)N[C@H]1c2ccccc2[C@H]3[C@@H]1CNC3 |
InChi: | InChI=1S/C16H22N2O2/c1-16(2,3)20-15(19)18-14-11-7-5-4-6-10(11)12-8-17-9-13(12)14/h4-7,12-14,17H,8-9H2,1-3H3,(H,18,19)/t12-,13-,14-/m0/s1 |
InChiKey: | InChIKey=VGRZZTKSOBMQQO-IHRRRGAJSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.