* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,16-HEPTADECAFLUOROHEXADECAN-7-ONE |
English Synonyms: | 9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,16-HEPTADECAFLUOROHEXADECAN-7-ONE |
MDL Number.: | MFCD16616433 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | CCCCCCC(=O)CC(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
InChi: | InChI=1S/C16H15F17O/c1-2-3-4-5-6-8(34)7-9(17,18)10(19,20)11(21,22)12(23,24)13(25,26)14(27,28)15(29,30)16(31,32)33/h2-7H2,1H3 |
InChiKey: | InChIKey=LBQPHFQVSAAODK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.