* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | HANSA DW608 |
| English Synonyms: | HANSA DW608 |
| MDL Number.: | MFCD16616918 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | COc1cccc(c1)C(CO)C(F)(F)F |
| InChi: | InChI=1S/C10H11F3O2/c1-15-8-4-2-3-7(5-8)9(6-14)10(11,12)13/h2-5,9,14H,6H2,1H3 |
| InChiKey: | InChIKey=KXQSHWKCJQQNOI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.